C26H38N2O3 — CID 66691160
(4E,7E,10E,13E,16E,19E)-N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 66691160) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E,19E)-N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4E,7E,10E,13E,16E,19E)-N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 66691160 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (4E,7E,10E,13E,16E,19E)-N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)NCC1CC(=O)NO1 |
| InChI | InChI=1S/C26H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(29)27-23-24-22-26(30)28-31-24/h3-4,6-7,9-10,12-13,15-16,18-19,24H,2,5,8,11,14,17,20-23H2,1H3,(H,27,29)(H,28,30)/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | KVNUNJQRRZBUCN-SFGLVEFQSA-N |
| XLogP | 5.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|