C36H32F3NO4 — CID 66698264
4-benzyl-3-[4-methyl-2-[3-phenylmethoxy-5-[4-(trifluoromethyl)phenyl]phenyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 66698264) has the molecular formula C36H32F3NO4 and a molecular weight of 599.65 g/mol. Its IUPAC name is 4-benzyl-3-[4-methyl-2-[3-phenylmethoxy-5-[4-(trifluoromethyl)phenyl]phenyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[4-methyl-2-[3-phenylmethoxy-5-[4-(trifluoromethyl)phenyl]phenyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66698264 |
| Molecular Formula | C36H32F3NO4 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 4-benzyl-3-[4-methyl-2-[3-phenylmethoxy-5-[4-(trifluoromethyl)phenyl]phenyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CC(C(=O)N1C(=O)OCC1Cc1ccccc1)c1cc(OCc2ccccc2)cc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C36H32F3NO4/c1-24(2)17-33(34(41)40-31(23-44-35(40)42)18-25-9-5-3-6-10-25)29-19-28(27-13-15-30(16-14-27)36(37,38)39)20-32(21-29)43-22-26-11-7-4-8-12-26/h3-16,19-21,31,33H,1,17-18,22-23H2,2H3 |
| InChIKey | AREHJNFDCOAYRZ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|