C35H32INO4 — CID 143568224
(4S)-4-benzyl-3-[(2S)-2-[3-(4-iodophenyl)-5-phenylmethoxyphenyl]-4-methylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 143568224) has the molecular formula C35H32INO4 and a molecular weight of 657.55 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[3-(4-iodophenyl)-5-phenylmethoxyphenyl]-4-methylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[3-(4-iodophenyl)-5-phenylmethoxyphenyl]-4-methylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143568224 |
| Molecular Formula | C35H32INO4 |
| Molecular Weight | 657.55 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[3-(4-iodophenyl)-5-phenylmethoxyphenyl]-4-methylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CC(C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)c1cc(OCc2ccccc2)cc(-c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C35H32INO4/c1-24(2)17-33(34(38)37-31(23-41-35(37)39)18-25-9-5-3-6-10-25)29-19-28(27-13-15-30(36)16-14-27)20-32(21-29)40-22-26-11-7-4-8-12-26/h3-16,19-21,31,33H,1,17-18,22-23H2,2H3/t31-,33?/m0/s1 |
| InChIKey | HTPLVXSSHSPOSO-MOJIJOCKSA-N |
| XLogP | 8.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.55 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|