C31H37N3O7 — CID 6670819
8-[(2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 6670819) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is 8-[(2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 6670819 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 8-[(2S,3R,4R)-4-(1,3-benzodioxol-5-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCO[C@H]1OC(C(=O)N2CCC3(CC2)C(=O)NCN3c2ccccc2)=C[C@@H](c2ccc3c(c2)OCO3)[C@H]1CCCO |
| InChI | InChI=1S/C31H37N3O7/c1-2-38-29-23(9-6-16-35)24(21-10-11-25-26(17-21)40-20-39-25)18-27(41-29)28(36)33-14-12-31(13-15-33)30(37)32-19-34(31)22-7-4-3-5-8-22/h3-5,7-8,10-11,17-18,23-24,29,35H,2,6,9,12-16,19-20H2,1H3,(H,32,37)/t23-,24+,29+/m1/s1 |
| InChIKey | LJHSIZJQJQIDAO-UQARTHHBSA-N |
| XLogP | 3.12 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |