C35H43N5O6 — CID 6671513
8-[(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 6671513) has the molecular formula C35H43N5O6 and a molecular weight of 629.76 g/mol. Its IUPAC name is 8-[(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 6671513 |
| Molecular Formula | C35H43N5O6 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.32 |
| IUPAC Name | 8-[(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCO[C@H]1OC(C(=O)N2CCC3(CC2)C(=O)NCN3c2ccccc2)=C[C@@H](c2c(C)n(C)n(-c3ccccc3)c2=O)[C@@H]1CCCO |
| InChI | InChI=1S/C35H43N5O6/c1-4-45-33-27(16-11-21-41)28(30-24(2)37(3)40(32(30)43)26-14-9-6-10-15-26)22-29(46-33)31(42)38-19-17-35(18-20-38)34(44)36-23-39(35)25-12-7-5-8-13-25/h5-10,12-15,22,27-28,33,41H,4,11,16-21,23H2,1-3H3,(H,36,44)/t27-,28+,33-/m0/s1 |
| InChIKey | XOYJFNNWBHQLMJ-DWZXRANWSA-N |
| XLogP | 3.19 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |