C29H39N3O5 — CID 6670884
(2S,3R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670884) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is (2S,3R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670884 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | (2S,3R,4R)-N-(2-bicyclo[2.2.1]heptanyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NC2CC3CCC2C3)=C[C@@H](c2c(C)n(C)n(-c3ccccc3)c2=O)[C@H]1CCCO |
| InChI | InChI=1S/C29H39N3O5/c1-4-36-29-22(11-8-14-33)23(17-25(37-29)27(34)30-24-16-19-12-13-20(24)15-19)26-18(2)31(3)32(28(26)35)21-9-6-5-7-10-21/h5-7,9-10,17,19-20,22-24,29,33H,4,8,11-16H2,1-3H3,(H,30,34)/t19?,20?,22-,23-,24?,29+/m1/s1 |
| InChIKey | RVGCGRMGJIQLFW-ZJZLAVKMSA-N |
| XLogP | 3.54 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |