C19H27NO2 — CID 66708239
(3S,9S,10R,13S,14S,17S)-3-amino-17-hydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one (PubChem CID 66708239) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (3S,9S,10R,13S,14S,17S)-3-amino-17-hydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (3S,9S,10R,13S,14S,17S)-3-amino-17-hydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 66708239 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (3S,9S,10R,13S,14S,17S)-3-amino-17-hydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C[C@]12CC[C@H]3C(=CC=C4C[C@@H](N)CC[C@@]43C)[C@@H]1CC(=O)[C@H]2O |
| InChI | InChI=1S/C19H27NO2/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3-4,12,14-15,17,22H,5-10,20H2,1-2H3/t12-,14-,15-,17+,18-,19-/m0/s1 |
| InChIKey | UYSVOSTXUDPUCF-BNFNPCLUSA-N |
| XLogP | 2.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |