C20H30FNO3 — CID 66708361
(9S,10R,13S,14S)-17-amino-16-fluoro-1,10,13-trimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,7,17-triol (PubChem CID 66708361) has the molecular formula C20H30FNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is (9S,10R,13S,14S)-17-amino-16-fluoro-1,10,13-trimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,7,17-triol.
| Compound Name | (9S,10R,13S,14S)-17-amino-16-fluoro-1,10,13-trimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,7,17-triol |
|---|---|
| PubChem CID | 66708361 |
| Molecular Formula | C20H30FNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (9S,10R,13S,14S)-17-amino-16-fluoro-1,10,13-trimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,7,17-triol |
| SMILES | CC1CC(O)CC2=CC(O)=C3[C@@H](CC[C@@]4(C)[C@H]3CC(F)C4(N)O)[C@]21C |
| InChI | InChI=1S/C20H30FNO3/c1-10-6-12(23)7-11-8-15(24)17-13(19(10,11)3)4-5-18(2)14(17)9-16(21)20(18,22)25/h8,10,12-14,16,23-25H,4-7,9,22H2,1-3H3/t10?,12?,13-,14+,16?,18+,19+,20?/m1/s1 |
| InChIKey | ORPDJCMSUIKZPJ-VBNUSKCLSA-N |
| XLogP | 2.96 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|