C19H28FNO3 — CID 66708650
(9S,10R,13S,14R)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,7-triol (PubChem CID 66708650) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is (9S,10R,13S,14R)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,7-triol.
| Compound Name | (9S,10R,13S,14R)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 66708650 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | (9S,10R,13S,14R)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,7-triol |
| SMILES | C[C@]12CC(O)C(O)CC1=CC(O)=C1[C@H]2CC[C@]2(C)C(N)C(F)C[C@@H]12 |
| InChI | InChI=1S/C19H28FNO3/c1-18-4-3-10-16(11(18)7-12(20)17(18)21)14(23)6-9-5-13(22)15(24)8-19(9,10)2/h6,10-13,15,17,22-24H,3-5,7-8,21H2,1-2H3/t10-,11+,12?,13?,15?,17?,18+,19+/m1/s1 |
| InChIKey | JDIGNENCWFGUQZ-IUXHJOJGSA-N |
| XLogP | 2.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |