C19H26FNO2 — CID 69400589
(8R,9S,10S,13S,14S,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 69400589) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (8R,9S,10S,13S,14S,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 69400589 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (8R,9S,10S,13S,14S,16R,17R)-17-amino-16-fluoro-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C=C(O)C(O)=C[C@@]43C)[C@@H]1C[C@@H](F)[C@@H]2N |
| InChI | InChI=1S/C19H26FNO2/c1-18-6-5-12-11(13(18)8-14(20)17(18)21)4-3-10-7-15(22)16(23)9-19(10,12)2/h3,7,9,11-14,17,22-23H,4-6,8,21H2,1-2H3/t11-,12+,13+,14-,17+,18+,19+/m1/s1 |
| InChIKey | LWMZKKDZLLVDAA-BNSDSJKXSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |