C23H26O2 — CID 69398808
2-[(8S,9R,10R,13S,14S)-3-(2-hydroxyethynyl)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl]ethynol (PubChem CID 69398808) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[(8S,9R,10R,13S,14S)-3-(2-hydroxyethynyl)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl]ethynol.
| Compound Name | 2-[(8S,9R,10R,13S,14S)-3-(2-hydroxyethynyl)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl]ethynol |
|---|---|
| PubChem CID | 69398808 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[(8S,9R,10R,13S,14S)-3-(2-hydroxyethynyl)-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl]ethynol |
| SMILES | C[C@]12C=CC(C#CO)=CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(C#CO)CC[C@@H]12 |
| InChI | InChI=1S/C23H26O2/c1-22-12-8-21-19(20(22)6-4-17(22)10-14-25)5-3-18-15-16(9-13-24)7-11-23(18,21)2/h3,7,11,15,17,19-21,24-25H,4-6,8,12H2,1-2H3/t17?,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | LWYTWIPRSMTNQU-CZJRHBCOSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|