C16H27N3O4 — CID 66713407
2-(4-aminobutylamino)acetic acid;2-[[(1S)-1-phenylethyl]amino]acetic acid (PubChem CID 66713407) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(4-aminobutylamino)acetic acid;2-[[(1S)-1-phenylethyl]amino]acetic acid.
| Compound Name | 2-(4-aminobutylamino)acetic acid;2-[[(1S)-1-phenylethyl]amino]acetic acid |
|---|---|
| PubChem CID | 66713407 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-(4-aminobutylamino)acetic acid;2-[[(1S)-1-phenylethyl]amino]acetic acid |
| SMILES | C[C@H](NCC(=O)O)c1ccccc1.NCCCCNCC(=O)O |
| InChI | InChI=1S/C10H13NO2.C6H14N2O2/c1-8(11-7-10(12)13)9-5-3-2-4-6-9;7-3-1-2-4-8-5-6(9)10/h2-6,8,11H,7H2,1H3,(H,12,13);8H,1-5,7H2,(H,9,10)/t8-;/m0./s1 |
| InChIKey | UJYVZGCRDCSZRD-QRPNPIFTSA-N |
| XLogP | 0.82 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|