C21H21F2NS — CID 66714075
2-(2,4-difluorophenyl)-4-(5-hexylthiophen-2-yl)pyridine (PubChem CID 66714075) has the molecular formula C21H21F2NS and a molecular weight of 357.47 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-(5-hexylthiophen-2-yl)pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-4-(5-hexylthiophen-2-yl)pyridine |
|---|---|
| PubChem CID | 66714075 |
| Molecular Formula | C21H21F2NS |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-(5-hexylthiophen-2-yl)pyridine |
| SMILES | CCCCCCc1ccc(-c2ccnc(-c3ccc(F)cc3F)c2)s1 |
| InChI | InChI=1S/C21H21F2NS/c1-2-3-4-5-6-17-8-10-21(25-17)15-11-12-24-20(13-15)18-9-7-16(22)14-19(18)23/h7-14H,2-6H2,1H3 |
| InChIKey | YQKLGWGZQGRKFZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|