C22H26BrN3 — CID 66715387
6-bromo-3-butyl-N-[4-[(dimethylamino)methyl]phenyl]quinolin-4-amine (PubChem CID 66715387) has the molecular formula C22H26BrN3 and a molecular weight of 412.38 g/mol. Its IUPAC name is 6-bromo-3-butyl-N-[4-[(dimethylamino)methyl]phenyl]quinolin-4-amine.
| Compound Name | 6-bromo-3-butyl-N-[4-[(dimethylamino)methyl]phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 66715387 |
| Molecular Formula | C22H26BrN3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 6-bromo-3-butyl-N-[4-[(dimethylamino)methyl]phenyl]quinolin-4-amine |
| SMILES | CCCCc1cnc2ccc(Br)cc2c1Nc1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C22H26BrN3/c1-4-5-6-17-14-24-21-12-9-18(23)13-20(21)22(17)25-19-10-7-16(8-11-19)15-26(2)3/h7-14H,4-6,15H2,1-3H3,(H,24,25) |
| InChIKey | HOWCHWWLWGJGIR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |