C9H8IN5S — CID 66716941
2-(1-ethylpyrazol-4-yl)-5-iodoimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 66716941) has the molecular formula C9H8IN5S and a molecular weight of 345.17 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-5-iodoimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-5-iodoimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 66716941 |
| Molecular Formula | C9H8IN5S |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-5-iodoimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCn1cc(-c2nn3c(I)cnc3s2)cn1 |
| InChI | InChI=1S/C9H8IN5S/c1-2-14-5-6(3-12-14)8-13-15-7(10)4-11-9(15)16-8/h3-5H,2H2,1H3 |
| InChIKey | XYENNOOASGKRJJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|