C38H42N12O3 — CID 66737049
1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(1R,2S,3R,4S)-4-(4-ethyltriazol-2-yl)-2,3-dihydroxycyclopentyl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea (PubChem CID 66737049) has the molecular formula C38H42N12O3 and a molecular weight of 714.84 g/mol. Its IUPAC name is 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(1R,2S,3R,4S)-4-(4-ethyltriazol-2-yl)-2,3-dihydroxycyclopentyl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(1R,2S,3R,4S)-4-(4-ethyltriazol-2-yl)-2,3-dihydroxycyclopentyl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 66737049 |
| Molecular Formula | C38H42N12O3 |
| Molecular Weight | 714.84 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | 1-[(3R)-1-[6-(2,2-diphenylethylamino)-9-[(1R,2S,3R,4S)-4-(4-ethyltriazol-2-yl)-2,3-dihydroxycyclopentyl]purin-2-yl]pyrrolidin-3-yl]-3-pyridin-3-ylurea |
| SMILES | CCc1cnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CC[C@@H](NC(=O)Nc6cccnc6)C5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C38H42N12O3/c1-2-26-20-42-50(47-26)31-18-30(33(51)34(31)52)49-23-41-32-35(40-21-29(24-10-5-3-6-11-24)25-12-7-4-8-13-25)45-37(46-36(32)49)48-17-15-28(22-48)44-38(53)43-27-14-9-16-39-19-27/h3-14,16,19-20,23,28-31,33-34,51-52H,2,15,17-18,21-22H2,1H3,(H,40,45,46)(H2,43,44,53)/t28-,30-,31+,33+,34-/m1/s1 |
| InChIKey | DLDXBGHYVCKULH-PJNXXVMGSA-N |
| XLogP | 3.93 |
| TPSA | 184.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |