C24H30N4O2 — CID 66744749
1-[4-(5,7-dimethoxyquinazolin-2-yl)phenyl]-N-propan-2-ylpiperidin-4-amine (PubChem CID 66744749) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[4-(5,7-dimethoxyquinazolin-2-yl)phenyl]-N-propan-2-ylpiperidin-4-amine.
| Compound Name | 1-[4-(5,7-dimethoxyquinazolin-2-yl)phenyl]-N-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 66744749 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-[4-(5,7-dimethoxyquinazolin-2-yl)phenyl]-N-propan-2-ylpiperidin-4-amine |
| SMILES | COc1cc(OC)c2cnc(-c3ccc(N4CCC(NC(C)C)CC4)cc3)nc2c1 |
| InChI | InChI=1S/C24H30N4O2/c1-16(2)26-18-9-11-28(12-10-18)19-7-5-17(6-8-19)24-25-15-21-22(27-24)13-20(29-3)14-23(21)30-4/h5-8,13-16,18,26H,9-12H2,1-4H3 |
| InChIKey | GQDKVVLPSGWIME-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |