C22H40ClO2P — CID 66766545
benzyl-(dihydroxymethyl)-tetradecylphosphanium chloride (PubChem CID 66766545) has the molecular formula C22H40ClO2P and a molecular weight of 402.99 g/mol. Its IUPAC name is benzyl-(dihydroxymethyl)-tetradecylphosphanium chloride.
| Compound Name | benzyl-(dihydroxymethyl)-tetradecylphosphanium chloride |
|---|---|
| PubChem CID | 66766545 |
| Molecular Formula | C22H40ClO2P |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | benzyl-(dihydroxymethyl)-tetradecylphosphanium chloride |
| SMILES | CCCCCCCCCCCCCC[PH+](Cc1ccccc1)C(O)O.[Cl-] |
| InChI | InChI=1S/C22H39O2P.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-16-19-25(22(23)24)20-21-17-14-13-15-18-21;/h13-15,17-18,22-24H,2-12,16,19-20H2,1H3;1H |
| InChIKey | IBCMGQMJZYCCQH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|