C15H19N3O4 — CID 66769782
2,3-dimethoxy-6-(morpholin-4-ylmethyl)quinazolin-4-one (PubChem CID 66769782) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2,3-dimethoxy-6-(morpholin-4-ylmethyl)quinazolin-4-one.
| Compound Name | 2,3-dimethoxy-6-(morpholin-4-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 66769782 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2,3-dimethoxy-6-(morpholin-4-ylmethyl)quinazolin-4-one |
| SMILES | COc1nc2ccc(CN3CCOCC3)cc2c(=O)n1OC |
| InChI | InChI=1S/C15H19N3O4/c1-20-15-16-13-4-3-11(10-17-5-7-22-8-6-17)9-12(13)14(19)18(15)21-2/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | DSLHOPVOBBPGQM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |