C19H27N3O4 — CID 78859070
3-butyl-6,7-dimethoxy-2-(morpholin-4-ylmethyl)quinazolin-4-one (PubChem CID 78859070) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-butyl-6,7-dimethoxy-2-(morpholin-4-ylmethyl)quinazolin-4-one.
| Compound Name | 3-butyl-6,7-dimethoxy-2-(morpholin-4-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 78859070 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 3-butyl-6,7-dimethoxy-2-(morpholin-4-ylmethyl)quinazolin-4-one |
| SMILES | CCCCn1c(CN2CCOCC2)nc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C19H27N3O4/c1-4-5-6-22-18(13-21-7-9-26-10-8-21)20-15-12-17(25-3)16(24-2)11-14(15)19(22)23/h11-12H,4-10,13H2,1-3H3 |
| InChIKey | OPDWQWVQIQUERL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |