C19H29N3O2 — CID 66776189
[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] N-pentylcarbamate (PubChem CID 66776189) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is [2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] N-pentylcarbamate.
| Compound Name | [2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] N-pentylcarbamate |
|---|---|
| PubChem CID | 66776189 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | [2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl] N-pentylcarbamate |
| SMILES | CCCCCNC(=O)OC1C2CCN(CC2)C1Cc1cccnc1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-3-4-10-21-19(23)24-18-16-7-11-22(12-8-16)17(18)13-15-6-5-9-20-14-15/h5-6,9,14,16-18H,2-4,7-8,10-13H2,1H3,(H,21,23) |
| InChIKey | ZLQGZRPHYRXRKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|