C18H18O3S — CID 66776218
(4-methoxyphenyl)-[2-(1,3-oxathian-2-yl)phenyl]methanone (PubChem CID 66776218) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (4-methoxyphenyl)-[2-(1,3-oxathian-2-yl)phenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[2-(1,3-oxathian-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 66776218 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4-methoxyphenyl)-[2-(1,3-oxathian-2-yl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccccc2C2OCCCS2)cc1 |
| InChI | InChI=1S/C18H18O3S/c1-20-14-9-7-13(8-10-14)17(19)15-5-2-3-6-16(15)18-21-11-4-12-22-18/h2-3,5-10,18H,4,11-12H2,1H3 |
| InChIKey | QTEAZWXECRKIPB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |