C22H30N4O4S — CID 66777758
3-(4-methylsulfonylpiperazin-1-yl)-6-(4-phenylmethoxycyclohexyl)oxypyridazine (PubChem CID 66777758) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-(4-methylsulfonylpiperazin-1-yl)-6-(4-phenylmethoxycyclohexyl)oxypyridazine.
| Compound Name | 3-(4-methylsulfonylpiperazin-1-yl)-6-(4-phenylmethoxycyclohexyl)oxypyridazine |
|---|---|
| PubChem CID | 66777758 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-(4-methylsulfonylpiperazin-1-yl)-6-(4-phenylmethoxycyclohexyl)oxypyridazine |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(OC3CCC(OCc4ccccc4)CC3)nn2)CC1 |
| InChI | InChI=1S/C22H30N4O4S/c1-31(27,28)26-15-13-25(14-16-26)21-11-12-22(24-23-21)30-20-9-7-19(8-10-20)29-17-18-5-3-2-4-6-18/h2-6,11-12,19-20H,7-10,13-17H2,1H3 |
| InChIKey | AICNRJPXYRGDKM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |