C34H48N6O6 — CID 66781431
4-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;benzene-1,3-dicarboxamide (PubChem CID 66781431) has the molecular formula C34H48N6O6 and a molecular weight of 636.79 g/mol. Its IUPAC name is 4-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;benzene-1,3-dicarboxamide.
| Compound Name | 4-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 66781431 |
| Molecular Formula | C34H48N6O6 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | 4-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;benzene-1,3-dicarboxamide |
| SMILES | NC(=O)CCCCC(=O)N1CCCCCC1.NC(=O)c1ccc(C(=O)N2CCCCCC2)cc1.NC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C14H18N2O2.C12H22N2O2.C8H8N2O2/c15-13(17)11-5-7-12(8-6-11)14(18)16-9-3-1-2-4-10-16;13-11(15)7-3-4-8-12(16)14-9-5-1-2-6-10-14;9-7(11)5-2-1-3-6(4-5)8(10)12/h5-8H,1-4,9-10H2,(H2,15,17);1-10H2,(H2,13,15);1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | DLXVFOCAFPKXTA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 212.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|