C20H31N3O3 — CID 70232811
3-(azepane-1-carbonyl)benzamide;hexanamide (PubChem CID 70232811) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-(azepane-1-carbonyl)benzamide;hexanamide.
| Compound Name | 3-(azepane-1-carbonyl)benzamide;hexanamide |
|---|---|
| PubChem CID | 70232811 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 3-(azepane-1-carbonyl)benzamide;hexanamide |
| SMILES | CCCCCC(N)=O.NC(=O)c1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C14H18N2O2.C6H13NO/c15-13(17)11-6-5-7-12(10-11)14(18)16-8-3-1-2-4-9-16;1-2-3-4-5-6(7)8/h5-7,10H,1-4,8-9H2,(H2,15,17);2-5H2,1H3,(H2,7,8) |
| InChIKey | PKXPLLJEMUSGDC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|