About 3-(azepane-1-carbonyl)benzamide;hexanamide
3-(azepane-1-carbonyl)benzamide;hexanamide (PubChem CID 70232811) has the molecular formula C20H31N3O3
and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-(azepane-1-carbonyl)benzamide;hexanamide.
Molecular Properties
| Compound Name | 3-(azepane-1-carbonyl)benzamide;hexanamide |
| PubChem CID | 70232811 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 3-(azepane-1-carbonyl)benzamide;hexanamide |
| SMILES | CCCCCC(N)=O.NC(=O)c1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C14H18N2O2.C6H13NO/c15-13(17)11-6-5-7-12(10-11)14(18)16-8-3-1-2-4-9-16;1-2-3-4-5-6(7)8/h5-7,10H,1-4,8-9H2,(H2,15,17);2-5H2,1H3,(H2,7,8) |
| InChIKey | PKXPLLJEMUSGDC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(azepane-1-carbonyl)benzamide;hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepane-1-carbonyl)benzamide;hexanamide?
The IUPAC name of 3-(azepane-1-carbonyl)benzamide;hexanamide (CID 70232811) is 3-(azepane-1-carbonyl)benzamide;hexanamide.
What is the SMILES notation for 3-(azepane-1-carbonyl)benzamide;hexanamide?
The canonical SMILES for 3-(azepane-1-carbonyl)benzamide;hexanamide is CCCCCC(N)=O.NC(=O)c1cccc(C(=O)N2CCCCCC2)c1.
What is the InChIKey of 3-(azepane-1-carbonyl)benzamide;hexanamide?
The InChIKey is PKXPLLJEMUSGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2.C6H13NO/c15-13(17)11-6-5-7-12(10-11)14(18)16-8-3-1-2-4-9-16;1-2-3-4-5-6(7)8/h5-7,10H,1-4,8-9H2,(H2,15,17);2-5H2,1H3,(H2,7,8).
What are the key properties of 3-(azepane-1-carbonyl)benzamide;hexanamide?
3-(azepane-1-carbonyl)benzamide;hexanamide has a molecular weight of 361.49 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepane-1-carbonyl)benzamide;hexanamide is sourced from PubChem (CID 70232811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).