C40H58N6O6 — CID 66925902
3-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;5,6,7,8,9,10-hexahydrobenzo[8]annulene-1,4-dicarboxamide (PubChem CID 66925902) has the molecular formula C40H58N6O6 and a molecular weight of 718.94 g/mol. Its IUPAC name is 3-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;5,6,7,8,9,10-hexahydrobenzo[8]annulene-1,4-dicarboxamide.
| Compound Name | 3-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;5,6,7,8,9,10-hexahydrobenzo[8]annulene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 66925902 |
| Molecular Formula | C40H58N6O6 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.44 |
| IUPAC Name | 3-(azepane-1-carbonyl)benzamide;6-(azepan-1-yl)-6-oxohexanamide;5,6,7,8,9,10-hexahydrobenzo[8]annulene-1,4-dicarboxamide |
| SMILES | NC(=O)CCCCC(=O)N1CCCCCC1.NC(=O)c1ccc(C(N)=O)c2c1CCCCCC2.NC(=O)c1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/2C14H18N2O2.C12H22N2O2/c15-13(17)11-6-5-7-12(10-11)14(18)16-8-3-1-2-4-9-16;15-13(17)11-7-8-12(14(16)18)10-6-4-2-1-3-5-9(10)11;13-11(15)7-3-4-8-12(16)14-9-5-1-2-6-10-14/h5-7,10H,1-4,8-9H2,(H2,15,17);7-8H,1-6H2,(H2,15,17)(H2,16,18);1-10H2,(H2,13,15) |
| InChIKey | QOLSAVWSZYNRBB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 212.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|