C18H22N2O4 — CID 66781958
2-(2-aminoethylamino)-2,2-bis(2-hydroxy-4-methylphenyl)acetic acid (PubChem CID 66781958) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-2,2-bis(2-hydroxy-4-methylphenyl)acetic acid.
| Compound Name | 2-(2-aminoethylamino)-2,2-bis(2-hydroxy-4-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 66781958 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(2-aminoethylamino)-2,2-bis(2-hydroxy-4-methylphenyl)acetic acid |
| SMILES | Cc1ccc(C(NCCN)(C(=O)O)c2ccc(C)cc2O)c(O)c1 |
| InChI | InChI=1S/C18H22N2O4/c1-11-3-5-13(15(21)9-11)18(17(23)24,20-8-7-19)14-6-4-12(2)10-16(14)22/h3-6,9-10,20-22H,7-8,19H2,1-2H3,(H,23,24) |
| InChIKey | LCLDECHFBJCYOE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|