C16H24O4 — CID 163086397
[(2R)-2-(2-hydroxy-4-methylphenyl)-2-methoxypropyl] (2R)-2-methylbutanoate (PubChem CID 163086397) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(2R)-2-(2-hydroxy-4-methylphenyl)-2-methoxypropyl] (2R)-2-methylbutanoate.
| Compound Name | [(2R)-2-(2-hydroxy-4-methylphenyl)-2-methoxypropyl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163086397 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(2R)-2-(2-hydroxy-4-methylphenyl)-2-methoxypropyl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)OC[C@](C)(OC)c1ccc(C)cc1O |
| InChI | InChI=1S/C16H24O4/c1-6-12(3)15(18)20-10-16(4,19-5)13-8-7-11(2)9-14(13)17/h7-9,12,17H,6,10H2,1-5H3/t12-,16+/m1/s1 |
| InChIKey | QREHUYSRIVVQLJ-WBMJQRKESA-N |
| XLogP | 3.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |