C27H37N5O3 — CID 66783787
9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(1-methylpyrazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 66783787) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(1-methylpyrazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(1-methylpyrazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 66783787 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(1-methylpyrazol-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | Cn1ccc(N2CC3(CCN(c4ccc(OC5CCN(C6CCC6)CC5)cc4)CC3)OCC2=O)n1 |
| InChI | InChI=1S/C27H37N5O3/c1-29-14-11-25(28-29)32-20-27(34-19-26(32)33)12-17-31(18-13-27)22-5-7-23(8-6-22)35-24-9-15-30(16-10-24)21-3-2-4-21/h5-8,11,14,21,24H,2-4,9-10,12-13,15-20H2,1H3 |
| InChIKey | QOUOYFJFOSCISE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|