C29H40N4O2 — CID 151463550
9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(6-methyl-3-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 151463550) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(6-methyl-3-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(6-methyl-3-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 151463550 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-(6-methyl-3-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | Cc1ccc(N2CCOC3(CCN(c4ccc(OC5CCN(C6CCC6)CC5)cc4)CC3)C2)cn1 |
| InChI | InChI=1S/C29H40N4O2/c1-23-5-6-26(21-30-23)33-19-20-34-29(22-33)13-17-32(18-14-29)25-7-9-27(10-8-25)35-28-11-15-31(16-12-28)24-3-2-4-24/h5-10,21,24,28H,2-4,11-20,22H2,1H3 |
| InChIKey | PIZBUAJQRNICLT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|