C31H38N4O3 — CID 66784278
(3R)-3-amino-1-[3-[6-(hydroxymethyl)-1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one (PubChem CID 66784278) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-[6-(hydroxymethyl)-1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one.
| Compound Name | (3R)-3-amino-1-[3-[6-(hydroxymethyl)-1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 66784278 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (3R)-3-amino-1-[3-[6-(hydroxymethyl)-1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)C[C@H](N)Cc3ccc4ccccc4c3)C2)nc2ccc(CO)cc21 |
| InChI | InChI=1S/C31H38N4O3/c1-38-15-5-14-35-29-18-23(21-36)10-12-28(29)33-31(35)26-8-4-13-34(20-26)30(37)19-27(32)17-22-9-11-24-6-2-3-7-25(24)16-22/h2-3,6-7,9-12,16,18,26-27,36H,4-5,8,13-15,17,19-21,32H2,1H3/t26?,27-/m1/s1 |
| InChIKey | FGCLVBMESVYFPE-SSYAZFEXSA-N |
| XLogP | 4.38 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|