C33H42N4O2 — CID 66791841
(3R)-3-amino-1-[3-[1-(3-methoxypropyl)-5-propan-2-ylbenzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one (PubChem CID 66791841) has the molecular formula C33H42N4O2 and a molecular weight of 526.73 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-[1-(3-methoxypropyl)-5-propan-2-ylbenzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one.
| Compound Name | (3R)-3-amino-1-[3-[1-(3-methoxypropyl)-5-propan-2-ylbenzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 66791841 |
| Molecular Formula | C33H42N4O2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (3R)-3-amino-1-[3-[1-(3-methoxypropyl)-5-propan-2-ylbenzimidazol-2-yl]piperidin-1-yl]-4-naphthalen-2-ylbutan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)C[C@H](N)Cc3ccc4ccccc4c3)C2)nc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C33H42N4O2/c1-23(2)26-13-14-31-30(20-26)35-33(37(31)16-7-17-39-3)28-10-6-15-36(22-28)32(38)21-29(34)19-24-11-12-25-8-4-5-9-27(25)18-24/h4-5,8-9,11-14,18,20,23,28-29H,6-7,10,15-17,19,21-22,34H2,1-3H3/t28?,29-/m1/s1 |
| InChIKey | ILGFPKRKAIKXSP-YPJJGMIRSA-N |
| XLogP | 6.02 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|