C26H32F2N4O2 — CID 66784478
3-amino-4-(3,4-difluorophenyl)-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 66784478) has the molecular formula C26H32F2N4O2 and a molecular weight of 470.56 g/mol. Its IUPAC name is 3-amino-4-(3,4-difluorophenyl)-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 3-amino-4-(3,4-difluorophenyl)-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 66784478 |
| Molecular Formula | C26H32F2N4O2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-amino-4-(3,4-difluorophenyl)-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(F)c(F)c3)C2)nc2ccccc21 |
| InChI | InChI=1S/C26H32F2N4O2/c1-34-13-5-12-32-24-8-3-2-7-23(24)30-26(32)19-6-4-11-31(17-19)25(33)16-20(29)14-18-9-10-21(27)22(28)15-18/h2-3,7-10,15,19-20H,4-6,11-14,16-17,29H2,1H3 |
| InChIKey | YWJSXHBGUFVEKK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|