C20H31N5O2 — CID 66786110
3,4-diamino-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 66786110) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3,4-diamino-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one.
| Compound Name | 3,4-diamino-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 66786110 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 3,4-diamino-1-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)CN)C2)nc2ccccc21 |
| InChI | InChI=1S/C20H31N5O2/c1-27-11-5-10-25-18-8-3-2-7-17(18)23-20(25)15-6-4-9-24(14-15)19(26)12-16(22)13-21/h2-3,7-8,15-16H,4-6,9-14,21-22H2,1H3 |
| InChIKey | SEPILITZQWTPPG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|