C33H37N5O2 — CID 66786711
4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]benzonitrile (PubChem CID 66786711) has the molecular formula C33H37N5O2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 66786711 |
| Molecular Formula | C33H37N5O2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]benzonitrile |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(-c4ccc(C#N)cc4)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C33H37N5O2/c1-40-19-5-18-38-31-8-3-2-7-30(31)36-33(38)28-6-4-17-37(23-28)32(39)21-29(35)20-24-9-13-26(14-10-24)27-15-11-25(22-34)12-16-27/h2-3,7-16,28-29H,4-6,17-21,23,35H2,1H3 |
| InChIKey | MESBUQYMHFUDBB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|