C32H39N5O2 — CID 66784798
(3R)-3-amino-4-[4-(4-aminophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 66784798) has the molecular formula C32H39N5O2 and a molecular weight of 525.70 g/mol. Its IUPAC name is (3R)-3-amino-4-[4-(4-aminophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-[4-(4-aminophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 66784798 |
| Molecular Formula | C32H39N5O2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (3R)-3-amino-4-[4-(4-aminophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@H](N)Cc3ccc(-c4ccc(N)cc4)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C32H39N5O2/c1-39-19-5-18-37-30-8-3-2-7-29(30)35-32(37)26-6-4-17-36(22-26)31(38)21-28(34)20-23-9-11-24(12-10-23)25-13-15-27(33)16-14-25/h2-3,7-16,26,28H,4-6,17-22,33-34H2,1H3/t26-,28-/m1/s1 |
| InChIKey | DCICNDRWGXCZBM-IXCJQBJRSA-N |
| XLogP | 4.99 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|