C36H45N5O4 — CID 66785546
4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-N-(2-methoxyethyl)benzamide (PubChem CID 66785546) has the molecular formula C36H45N5O4 and a molecular weight of 611.79 g/mol. Its IUPAC name is 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 66785546 |
| Molecular Formula | C36H45N5O4 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 4-[4-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]phenyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)Cc3ccc(-c4ccc(C(=O)NCCOC)cc4)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C36H45N5O4/c1-44-21-6-20-41-33-9-4-3-8-32(33)39-35(41)30-7-5-19-40(25-30)34(42)24-31(37)23-26-10-12-27(13-11-26)28-14-16-29(17-15-28)36(43)38-18-22-45-2/h3-4,8-17,30-31H,5-7,18-25,37H2,1-2H3,(H,38,43) |
| InChIKey | ATFAWXYRJVUIHQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|