C28H43N5O3 — CID 66786264
N-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-2-cyclohexylacetamide (PubChem CID 66786264) has the molecular formula C28H43N5O3 and a molecular weight of 497.68 g/mol. Its IUPAC name is N-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-2-cyclohexylacetamide.
| Compound Name | N-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 66786264 |
| Molecular Formula | C28H43N5O3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | N-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-2-cyclohexylacetamide |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@H](N)CNC(=O)CC3CCCCC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C28H43N5O3/c1-36-16-8-15-33-25-13-6-5-12-24(25)31-28(33)22-11-7-14-32(20-22)27(35)18-23(29)19-30-26(34)17-21-9-3-2-4-10-21/h5-6,12-13,21-23H,2-4,7-11,14-20,29H2,1H3,(H,30,34)/t22-,23+/m1/s1 |
| InChIKey | LOFFCTKNJUNWOQ-PKTZIBPZSA-N |
| XLogP | 3.58 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|