C27H34Cl2N6O3 — CID 66785238
1-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 66785238) has the molecular formula C27H34Cl2N6O3 and a molecular weight of 561.51 g/mol. Its IUPAC name is 1-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 66785238 |
| Molecular Formula | C27H34Cl2N6O3 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 1-[(2S)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@H](N)CNC(=O)Nc3ccc(Cl)c(Cl)c3)C2)nc2ccccc21 |
| InChI | InChI=1S/C27H34Cl2N6O3/c1-38-13-5-12-35-24-8-3-2-7-23(24)33-26(35)18-6-4-11-34(17-18)25(36)14-19(30)16-31-27(37)32-20-9-10-21(28)22(29)15-20/h2-3,7-10,15,18-19H,4-6,11-14,16-17,30H2,1H3,(H2,31,32,37)/t18-,19+/m1/s1 |
| InChIKey | LZWJLYBIPBDKNS-MOPGFXCFSA-N |
| XLogP | 4.62 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|