C31H44N6O5 — CID 66785963
1-[(2R)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-[1-methoxy-2-(3-methoxyphenyl)ethyl]urea (PubChem CID 66785963) has the molecular formula C31H44N6O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is 1-[(2R)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-[1-methoxy-2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[(2R)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-[1-methoxy-2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 66785963 |
| Molecular Formula | C31H44N6O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 1-[(2R)-2-amino-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-[1-methoxy-2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@@H](N)CNC(=O)NC(Cc3cccc(OC)c3)OC)C2)nc2ccccc21 |
| InChI | InChI=1S/C31H44N6O5/c1-40-16-8-15-37-27-13-5-4-12-26(27)34-30(37)23-10-7-14-36(21-23)29(38)19-24(32)20-33-31(39)35-28(42-3)18-22-9-6-11-25(17-22)41-2/h4-6,9,11-13,17,23-24,28H,7-8,10,14-16,18-21,32H2,1-3H3,(H2,33,35,39)/t23-,24-,28?/m1/s1 |
| InChIKey | IQEJCWMLBLTDIE-KDKXARBFSA-N |
| XLogP | 3.02 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|