C32H46N6O4 — CID 66784935
1-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(5-tert-butyl-2-methoxyphenyl)urea (PubChem CID 66784935) has the molecular formula C32H46N6O4 and a molecular weight of 578.76 g/mol. Its IUPAC name is 1-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(5-tert-butyl-2-methoxyphenyl)urea.
| Compound Name | 1-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(5-tert-butyl-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 66784935 |
| Molecular Formula | C32H46N6O4 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 1-[2-amino-4-[3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxobutyl]-3-(5-tert-butyl-2-methoxyphenyl)urea |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(N)CNC(=O)Nc3cc(C(C)(C)C)ccc3OC)C2)nc2ccccc21 |
| InChI | InChI=1S/C32H46N6O4/c1-32(2,3)23-13-14-28(42-5)26(18-23)36-31(40)34-20-24(33)19-29(39)37-15-8-10-22(21-37)30-35-25-11-6-7-12-27(25)38(30)16-9-17-41-4/h6-7,11-14,18,22,24H,8-10,15-17,19-21,33H2,1-5H3,(H2,34,36,40) |
| InChIKey | KLNFMPGIHHGMKB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|