C22H23N3O5S — CID 66787476
formic acid;2-[[3-[(4-methoxypiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 66787476) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is formic acid;2-[[3-[(4-methoxypiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | formic acid;2-[[3-[(4-methoxypiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 66787476 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | formic acid;2-[[3-[(4-methoxypiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | COC1CCN(Cc2coc3cc(Oc4nc5ncccc5s4)ccc23)CC1.O=CO |
| InChI | InChI=1S/C21H21N3O3S.CH2O2/c1-25-15-6-9-24(10-7-15)12-14-13-26-18-11-16(4-5-17(14)18)27-21-23-20-19(28-21)3-2-8-22-20;2-1-3/h2-5,8,11,13,15H,6-7,9-10,12H2,1H3;1H,(H,2,3) |
| InChIKey | FTCKDOFQIFMZOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|