C36H46N6O — CID 66791557
(3R)-3-amino-1-[(3R)-3-(1-butylbenzimidazol-2-yl)piperidin-1-yl]-4-[4-(4-phenylpiperazin-1-yl)phenyl]butan-1-one (PubChem CID 66791557) has the molecular formula C36H46N6O and a molecular weight of 578.81 g/mol. Its IUPAC name is (3R)-3-amino-1-[(3R)-3-(1-butylbenzimidazol-2-yl)piperidin-1-yl]-4-[4-(4-phenylpiperazin-1-yl)phenyl]butan-1-one.
| Compound Name | (3R)-3-amino-1-[(3R)-3-(1-butylbenzimidazol-2-yl)piperidin-1-yl]-4-[4-(4-phenylpiperazin-1-yl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 66791557 |
| Molecular Formula | C36H46N6O |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | (3R)-3-amino-1-[(3R)-3-(1-butylbenzimidazol-2-yl)piperidin-1-yl]-4-[4-(4-phenylpiperazin-1-yl)phenyl]butan-1-one |
| SMILES | CCCCn1c([C@@H]2CCCN(C(=O)C[C@H](N)Cc3ccc(N4CCN(c5ccccc5)CC4)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C36H46N6O/c1-2-3-20-42-34-14-8-7-13-33(34)38-36(42)29-10-9-19-41(27-29)35(43)26-30(37)25-28-15-17-32(18-16-28)40-23-21-39(22-24-40)31-11-5-4-6-12-31/h4-8,11-18,29-30H,2-3,9-10,19-27,37H2,1H3/t29-,30-/m1/s1 |
| InChIKey | FVCNNNOHLTWSCC-LOYHVIPDSA-N |
| XLogP | 5.83 |
| TPSA | 70.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|