C15H23BrO6 — CID 66791701
[1-(1,3-dioxetan-2-yl)-1-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-bromo-2-methylpropanoate (PubChem CID 66791701) has the molecular formula C15H23BrO6 and a molecular weight of 379.25 g/mol. Its IUPAC name is [1-(1,3-dioxetan-2-yl)-1-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-bromo-2-methylpropanoate.
| Compound Name | [1-(1,3-dioxetan-2-yl)-1-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 66791701 |
| Molecular Formula | C15H23BrO6 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [1-(1,3-dioxetan-2-yl)-1-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-bromo-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OC(C(CCC)OC(=O)C(C)(C)Br)C1OCO1 |
| InChI | InChI=1S/C15H23BrO6/c1-6-7-10(21-14(18)15(4,5)16)11(13-19-8-20-13)22-12(17)9(2)3/h10-11,13H,2,6-8H2,1,3-5H3 |
| InChIKey | OJTREIKSIPEQPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|