C25H24N2O3 — CID 66795318
ethyl 3-phenyl-1-(2-phenylmethoxyethyl)pyrrolo[2,3-b]pyridine-6-carboxylate (PubChem CID 66795318) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 3-phenyl-1-(2-phenylmethoxyethyl)pyrrolo[2,3-b]pyridine-6-carboxylate.
| Compound Name | ethyl 3-phenyl-1-(2-phenylmethoxyethyl)pyrrolo[2,3-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 66795318 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 3-phenyl-1-(2-phenylmethoxyethyl)pyrrolo[2,3-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(-c3ccccc3)cn(CCOCc3ccccc3)c2n1 |
| InChI | InChI=1S/C25H24N2O3/c1-2-30-25(28)23-14-13-21-22(20-11-7-4-8-12-20)17-27(24(21)26-23)15-16-29-18-19-9-5-3-6-10-19/h3-14,17H,2,15-16,18H2,1H3 |
| InChIKey | HTRBIGIXTPVAMG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|