C30H28F2N2O6 — CID 66797416
1-[(2S,5S)-3,3-difluoro-5-(methoxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 66797416) has the molecular formula C30H28F2N2O6 and a molecular weight of 550.56 g/mol. Its IUPAC name is 1-[(2S,5S)-3,3-difluoro-5-(methoxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-3,3-difluoro-5-(methoxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66797416 |
| Molecular Formula | C30H28F2N2O6 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 1-[(2S,5S)-3,3-difluoro-5-(methoxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC[C@@H]1O[C@H](n2ccc(=O)[nH]c2=O)C(F)(F)C1OC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H28F2N2O6/c1-37-19-24-26(30(31,32)27(39-24)34-18-17-25(35)33-28(34)36)40-29(20-9-5-3-6-10-20,21-11-7-4-8-12-21)22-13-15-23(38-2)16-14-22/h3-18,24,26-27H,19H2,1-2H3,(H,33,35,36)/t24-,26?,27-/m0/s1 |
| InChIKey | NZAJMSVHFGNYDQ-VNBODJOOSA-N |
| XLogP | 4.10 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|