C45H44F2N2O6Si — CID 169068564
1-[(2R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-difluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 169068564) has the molecular formula C45H44F2N2O6Si and a molecular weight of 774.94 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-difluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-difluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068564 |
| Molecular Formula | C45H44F2N2O6Si |
| Molecular Weight | 774.94 g/mol |
| Exact Mass | 774.29 |
| IUPAC Name | 1-[(2R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,3-difluoro-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@@H](n3ccc(=O)[nH]c3=O)C2(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H44F2N2O6Si/c1-43(2,3)56(36-21-13-7-14-22-36,37-23-15-8-16-24-37)53-31-38-40(45(46,47)41(54-38)49-30-29-39(50)48-42(49)51)55-44(32-17-9-5-10-18-32,33-19-11-6-12-20-33)34-25-27-35(52-4)28-26-34/h5-30,38,40-41H,31H2,1-4H3,(H,48,50,51)/t38-,40-,41-/m1/s1 |
| InChIKey | HRFOBWKHRZLFBQ-QDMAOYMRSA-N |
| XLogP | 7.03 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|