C36H41F2IN2O6Si — CID 169212957
1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(iodomethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 169212957) has the molecular formula C36H41F2IN2O6Si and a molecular weight of 790.72 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(iodomethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(iodomethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169212957 |
| Molecular Formula | C36H41F2IN2O6Si |
| Molecular Weight | 790.72 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluoro-5-(iodomethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H]2C(F)(F)[C@H](n3ccc(=O)[nH]c3=O)O[C@]2(CI)CO[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H41F2IN2O6Si/c1-33(2,3)48(5,6)45-24-34(23-39)30(36(37,38)31(47-34)41-22-21-29(42)40-32(41)43)46-35(25-13-9-7-10-14-25,26-15-11-8-12-16-26)27-17-19-28(44-4)20-18-27/h7-22,30-31H,23-24H2,1-6H3,(H,40,42,43)/t30-,31-,34-/m1/s1 |
| InChIKey | YCFHVOAPGKLKQB-MUZHKWOHSA-N |
| XLogP | 7.28 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|