C9H10BrN3S — CID 667991
(5R)-5-(bromomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 667991) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (5R)-5-(bromomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 667991 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | (5R)-5-(bromomethyl)-N-pyridin-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | BrC[C@H]1CN=C(Nc2ccccn2)S1 |
| InChI | InChI=1S/C9H10BrN3S/c10-5-7-6-12-9(14-7)13-8-3-1-2-4-11-8/h1-4,7H,5-6H2,(H,11,12,13)/t7-/m0/s1 |
| InChIKey | YHAYWMLDGALZBJ-ZETCQYMHSA-N |
| XLogP | 2.36 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|