C38H50N4O8 — CID 66800231
bis[(4aR,8aS)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl] 2,3-dibenzoyl-2,3-dihydroxybutanedioate (PubChem CID 66800231) has the molecular formula C38H50N4O8 and a molecular weight of 690.84 g/mol. Its IUPAC name is bis[(4aR,8aS)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl] 2,3-dibenzoyl-2,3-dihydroxybutanedioate.
| Compound Name | bis[(4aR,8aS)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl] 2,3-dibenzoyl-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 66800231 |
| Molecular Formula | C38H50N4O8 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | bis[(4aR,8aS)-2,2-dimethyl-3,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl] 2,3-dibenzoyl-2,3-dihydroxybutanedioate |
| SMILES | CC1(C)CN[C@@H]2CCCC[C@@H]2N1OC(=O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)ON1[C@H]2CCCC[C@H]2NCC1(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H50N4O8/c1-35(2)23-39-27-19-11-13-21-29(27)41(35)49-33(45)37(47,31(43)25-15-7-5-8-16-25)38(48,32(44)26-17-9-6-10-18-26)34(46)50-42-30-22-14-12-20-28(30)40-24-36(42,3)4/h5-10,15-18,27-30,39-40,47-48H,11-14,19-24H2,1-4H3/t27-,28-,29+,30+,37?,38?/m1/s1 |
| InChIKey | MSYCOKSDDHQZFW-UFYVGLPESA-N |
| XLogP | 3.12 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|